C17H19ClF3NO — CID 15449198
2-[2-(tert-butylamino)-5-chlorophenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol (PubChem CID 15449198) has the molecular formula C17H19ClF3NO and a molecular weight of 345.79 g/mol. Its IUPAC name is 2-[2-(tert-butylamino)-5-chlorophenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol.
| Compound Name | 2-[2-(tert-butylamino)-5-chlorophenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
|---|---|
| PubChem CID | 15449198 |
| Molecular Formula | C17H19ClF3NO |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[2-(tert-butylamino)-5-chlorophenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
| SMILES | CC(C)(C)Nc1ccc(Cl)cc1C(O)(C#CC1CC1)C(F)(F)F |
| InChI | InChI=1S/C17H19ClF3NO/c1-15(2,3)22-14-7-6-12(18)10-13(14)16(23,17(19,20)21)9-8-11-4-5-11/h6-7,10-11,22-23H,4-5H2,1-3H3 |
| InChIKey | OLGVSAQTZWHLHF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|