C14H14O3 — CID 15449233
3-oxahexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadecane-2,4-dione (PubChem CID 15449233) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-oxahexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadecane-2,4-dione.
| Compound Name | 3-oxahexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadecane-2,4-dione |
|---|---|
| PubChem CID | 15449233 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-oxahexacyclo[7.6.0.01,5.05,12.06,10.011,15]pentadecane-2,4-dione |
| SMILES | O=C1OC(=O)C23C4CCC5C4C4C(CCC42)C153 |
| InChI | InChI=1S/C14H14O3/c15-11-13-5-1-2-6-9(5)10-7(13)3-4-8(10)14(6,13)12(16)17-11/h5-10H,1-4H2 |
| InChIKey | HBHYSDLLXWCWIF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|