About 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline
2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline (PubChem CID 154494960) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline |
| PubChem CID | 154494960 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1C12CNC(CN1)C2 |
| InChI | InChI=1S/C13H19N3/c1-16(2)12-6-4-3-5-11(12)13-7-10(8-15-13)14-9-13/h3-6,10,14-15H,7-9H2,1-2H3 |
| InChIKey | XRENWTZAALXZLT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline?
The IUPAC name of 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline (CID 154494960) is 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline.
What is the SMILES notation for 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline?
The canonical SMILES for 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline is CN(C)c1ccccc1C12CNC(CN1)C2.
What is the InChIKey of 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline?
The InChIKey is XRENWTZAALXZLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-16(2)12-6-4-3-5-11(12)13-7-10(8-15-13)14-9-13/h3-6,10,14-15H,7-9H2,1-2H3.
What are the key properties of 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline?
2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline has a molecular weight of 217.32 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-diazabicyclo[2.2.1]heptan-1-yl)-N,N-dimethylaniline is sourced from PubChem (CID 154494960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).