C16H18N2O2 — CID 154495358
5-methoxy-11-methyl-1,11-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-2(7),3,5,8-tetraen-16-one (PubChem CID 154495358) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 5-methoxy-11-methyl-1,11-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-2(7),3,5,8-tetraen-16-one.
| Compound Name | 5-methoxy-11-methyl-1,11-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-2(7),3,5,8-tetraen-16-one |
|---|---|
| PubChem CID | 154495358 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 5-methoxy-11-methyl-1,11-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-2(7),3,5,8-tetraen-16-one |
| SMILES | COc1ccc2c(c1)cc1n2C(=O)C2CCCN(C)C12 |
| InChI | InChI=1S/C16H18N2O2/c1-17-7-3-4-12-15(17)14-9-10-8-11(20-2)5-6-13(10)18(14)16(12)19/h5-6,8-9,12,15H,3-4,7H2,1-2H3 |
| InChIKey | CTWBCVPFMAOZGL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |