C22H32N4O6 — CID 154495868
ethyl (E,6S)-6-acetamido-7-[[2-(2-methylpropylamino)-2-oxoethyl]-(2-oxo-1H-pyridin-3-yl)amino]-7-oxohept-2-enoate (PubChem CID 154495868) has the molecular formula C22H32N4O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is ethyl (E,6S)-6-acetamido-7-[[2-(2-methylpropylamino)-2-oxoethyl]-(2-oxo-1H-pyridin-3-yl)amino]-7-oxohept-2-enoate.
| Compound Name | ethyl (E,6S)-6-acetamido-7-[[2-(2-methylpropylamino)-2-oxoethyl]-(2-oxo-1H-pyridin-3-yl)amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 154495868 |
| Molecular Formula | C22H32N4O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | ethyl (E,6S)-6-acetamido-7-[[2-(2-methylpropylamino)-2-oxoethyl]-(2-oxo-1H-pyridin-3-yl)amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/CC[C@H](NC(C)=O)C(=O)N(CC(=O)NCC(C)C)c1ccc[nH]c1=O |
| InChI | InChI=1S/C22H32N4O6/c1-5-32-20(29)11-7-6-9-17(25-16(4)27)22(31)26(14-19(28)24-13-15(2)3)18-10-8-12-23-21(18)30/h7-8,10-12,15,17H,5-6,9,13-14H2,1-4H3,(H,23,30)(H,24,28)(H,25,27)/b11-7+/t17-/m0/s1 |
| InChIKey | ANZGJLHVKIKETA-ZBZNSMLMSA-N |
| XLogP | 0.88 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|