C10H18O2 — CID 154495976
(3R,6S)-2,6-dimethylocta-1,7-diene-3,6-diol (PubChem CID 154495976) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (3R,6S)-2,6-dimethylocta-1,7-diene-3,6-diol.
| Compound Name | (3R,6S)-2,6-dimethylocta-1,7-diene-3,6-diol |
|---|---|
| PubChem CID | 154495976 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3R,6S)-2,6-dimethylocta-1,7-diene-3,6-diol |
| SMILES | C=C[C@@](C)(O)CC[C@@H](O)C(=C)C |
| InChI | InChI=1S/C10H18O2/c1-5-10(4,12)7-6-9(11)8(2)3/h5,9,11-12H,1-2,6-7H2,3-4H3/t9-,10-/m1/s1 |
| InChIKey | HZHJGFRDKJPQPV-NXEZZACHSA-N |
| XLogP | 1.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|