C25H22O7 — CID 154496033
(11R)-6,7,15-trihydroxy-19,19-dimethyl-11-(2-methylprop-1-enyl)-2,10,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21),17-octaen-13-one (PubChem CID 154496033) has the molecular formula C25H22O7 and a molecular weight of 434.44 g/mol. Its IUPAC name is (11R)-6,7,15-trihydroxy-19,19-dimethyl-11-(2-methylprop-1-enyl)-2,10,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21),17-octaen-13-one.
| Compound Name | (11R)-6,7,15-trihydroxy-19,19-dimethyl-11-(2-methylprop-1-enyl)-2,10,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21),17-octaen-13-one |
|---|---|
| PubChem CID | 154496033 |
| Molecular Formula | C25H22O7 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (11R)-6,7,15-trihydroxy-19,19-dimethyl-11-(2-methylprop-1-enyl)-2,10,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21),17-octaen-13-one |
| SMILES | CC(C)=C[C@H]1Oc2cc(O)c(O)cc2-c2oc3cc4c(c(O)c3c(=O)c21)C=CC(C)(C)O4 |
| InChI | InChI=1S/C25H22O7/c1-11(2)7-18-21-23(29)20-19(10-17-12(22(20)28)5-6-25(3,4)32-17)31-24(21)13-8-14(26)15(27)9-16(13)30-18/h5-10,18,26-28H,1-4H3/t18-/m1/s1 |
| InChIKey | WCKLKGPVAVYYFW-GOSISDBHSA-N |
| XLogP | 5.16 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|