C26H38O4 — CID 154496108
3,5-dihydroxy-2-[(2R)-2-methylbutanoyl]-4,6,6-tris(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one (PubChem CID 154496108) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 3,5-dihydroxy-2-[(2R)-2-methylbutanoyl]-4,6,6-tris(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 3,5-dihydroxy-2-[(2R)-2-methylbutanoyl]-4,6,6-tris(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 154496108 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 3,5-dihydroxy-2-[(2R)-2-methylbutanoyl]-4,6,6-tris(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC[C@@H](C)C(=O)C1=C(O)C(CC=C(C)C)=C(O)C(CC=C(C)C)(CC=C(C)C)C1=O |
| InChI | InChI=1S/C26H38O4/c1-9-19(8)22(27)21-23(28)20(11-10-16(2)3)24(29)26(25(21)30,14-12-17(4)5)15-13-18(6)7/h10,12-13,19,28-29H,9,11,14-15H2,1-8H3/t19-/m1/s1 |
| InChIKey | QXPOWGXRDUFAQW-LJQANCHMSA-N |
| XLogP | 6.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|