C15H23BrO4 — CID 154496188
(1S,2S,5R,7S,9R,10S,12S)-5-bromo-2,4,4,10-tetramethyl-3,8,14-trioxatetracyclo[7.3.1.17,10.02,7]tetradecan-12-ol (PubChem CID 154496188) has the molecular formula C15H23BrO4 and a molecular weight of 347.25 g/mol. Its IUPAC name is (1S,2S,5R,7S,9R,10S,12S)-5-bromo-2,4,4,10-tetramethyl-3,8,14-trioxatetracyclo[7.3.1.17,10.02,7]tetradecan-12-ol.
| Compound Name | (1S,2S,5R,7S,9R,10S,12S)-5-bromo-2,4,4,10-tetramethyl-3,8,14-trioxatetracyclo[7.3.1.17,10.02,7]tetradecan-12-ol |
|---|---|
| PubChem CID | 154496188 |
| Molecular Formula | C15H23BrO4 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (1S,2S,5R,7S,9R,10S,12S)-5-bromo-2,4,4,10-tetramethyl-3,8,14-trioxatetracyclo[7.3.1.17,10.02,7]tetradecan-12-ol |
| SMILES | CC1(C)O[C@@]2(C)[C@H]3C[C@H]4O[C@@]2(C[C@H]1Br)O[C@@]4(C)C[C@@H]3O |
| InChI | InChI=1S/C15H23BrO4/c1-12(2)10(16)7-15-14(4,19-12)8-5-11(18-15)13(3,20-15)6-9(8)17/h8-11,17H,5-7H2,1-4H3/t8-,9-,10+,11+,13-,14-,15-/m0/s1 |
| InChIKey | JAWMXSKLDOVARM-XDGOOXBHSA-N |
| XLogP | 2.36 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|