About 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine
5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 15449672) has the molecular formula C10H12N4S
and a molecular weight of 220.30 g/mol. Its IUPAC name is 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 15449672 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(-c2ccccc2N)s1 |
| InChI | InChI=1S/C10H12N4S/c1-14(2)10-13-12-9(15-10)7-5-3-4-6-8(7)11/h3-6H,11H2,1-2H3 |
| InChIKey | QGIDKGRWRWZHFT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine (CID 15449672) is 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine is CN(C)c1nnc(-c2ccccc2N)s1.
What is the InChIKey of 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine?
The InChIKey is QGIDKGRWRWZHFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4S/c1-14(2)10-13-12-9(15-10)7-5-3-4-6-8(7)11/h3-6H,11H2,1-2H3.
What are the key properties of 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine?
5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine has a molecular weight of 220.30 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminophenyl)-N,N-dimethyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 15449672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).