C11H16O7 — CID 154496873
methyl (4R,4aR,5R,6S,7S,7aS)-5,6,7-trihydroxy-7-methyl-1-oxo-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 154496873) has the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. Its IUPAC name is methyl (4R,4aR,5R,6S,7S,7aS)-5,6,7-trihydroxy-7-methyl-1-oxo-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (4R,4aR,5R,6S,7S,7aS)-5,6,7-trihydroxy-7-methyl-1-oxo-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 154496873 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | methyl (4R,4aR,5R,6S,7S,7aS)-5,6,7-trihydroxy-7-methyl-1-oxo-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)[C@H]1COC(=O)[C@H]2[C@@H]1[C@@H](O)[C@H](O)[C@@]2(C)O |
| InChI | InChI=1S/C11H16O7/c1-11(16)6-5(7(12)8(11)13)4(9(14)17-2)3-18-10(6)15/h4-8,12-13,16H,3H2,1-2H3/t4-,5+,6+,7+,8-,11-/m0/s1 |
| InChIKey | CWCMFEDIQBKDKW-QLEYKBNASA-N |
| XLogP | -1.95 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |