C14H25NO — CID 154497067
(2E,4E)-N-[(2R)-butan-2-yl]deca-2,4-dienamide (PubChem CID 154497067) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (2E,4E)-N-[(2R)-butan-2-yl]deca-2,4-dienamide.
| Compound Name | (2E,4E)-N-[(2R)-butan-2-yl]deca-2,4-dienamide |
|---|---|
| PubChem CID | 154497067 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (2E,4E)-N-[(2R)-butan-2-yl]deca-2,4-dienamide |
| SMILES | CCCCC/C=C/C=C/C(=O)N[C@H](C)CC |
| InChI | InChI=1S/C14H25NO/c1-4-6-7-8-9-10-11-12-14(16)15-13(3)5-2/h9-13H,4-8H2,1-3H3,(H,15,16)/b10-9+,12-11+/t13-/m1/s1 |
| InChIKey | QMIWSRNEYNUYFE-WKOVGYJXSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|