C24H22O10 — CID 154497261
6-methoxy-2-[3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]furo[2,3-h]chromen-4-one (PubChem CID 154497261) has the molecular formula C24H22O10 and a molecular weight of 470.43 g/mol. Its IUPAC name is 6-methoxy-2-[3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]furo[2,3-h]chromen-4-one.
| Compound Name | 6-methoxy-2-[3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]furo[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 154497261 |
| Molecular Formula | C24H22O10 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 6-methoxy-2-[3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]furo[2,3-h]chromen-4-one |
| SMILES | COc1cc2c(=O)cc(-c3cccc(O[C@@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O)c3)oc2c2ccoc12 |
| InChI | InChI=1S/C24H22O10/c1-30-17-8-14-15(26)9-16(33-22(14)13-5-6-31-23(13)17)11-3-2-4-12(7-11)32-24-21(29)20(28)19(27)18(10-25)34-24/h2-9,18-21,24-25,27-29H,10H2,1H3/t18-,19+,20+,21-,24-/m1/s1 |
| InChIKey | BCMOCRMQUUKQHC-IZBDVAQHSA-N |
| XLogP | 1.39 |
| TPSA | 151.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |