C11H12FN7O — CID 154498519
4-amino-6-(2-fluoro-5-methylanilino)-N'-hydroxy-1,3,5-triazine-2-carboximidamide (PubChem CID 154498519) has the molecular formula C11H12FN7O and a molecular weight of 277.26 g/mol. Its IUPAC name is 4-amino-6-(2-fluoro-5-methylanilino)-N'-hydroxy-1,3,5-triazine-2-carboximidamide.
| Compound Name | 4-amino-6-(2-fluoro-5-methylanilino)-N'-hydroxy-1,3,5-triazine-2-carboximidamide |
|---|---|
| PubChem CID | 154498519 |
| Molecular Formula | C11H12FN7O |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-amino-6-(2-fluoro-5-methylanilino)-N'-hydroxy-1,3,5-triazine-2-carboximidamide |
| SMILES | Cc1ccc(F)c(Nc2nc(N)nc(C(N)=NO)n2)c1 |
| InChI | InChI=1S/C11H12FN7O/c1-5-2-3-6(12)7(4-5)15-11-17-9(8(13)19-20)16-10(14)18-11/h2-4,20H,1H3,(H2,13,19)(H3,14,15,16,17,18) |
| InChIKey | IJONMRBMFUXESQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 135.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|