About 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol
1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol (PubChem CID 154498857) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol.
Molecular Properties
| Compound Name | 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol |
| PubChem CID | 154498857 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol |
| SMILES | OCC12CCC(CO)(C1)C(O)=C2O |
| InChI | InChI=1S/C9H14O4/c10-4-8-1-2-9(3-8,5-11)7(13)6(8)12/h10-13H,1-5H2 |
| InChIKey | QNITVHBMMYEDQN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol?
The IUPAC name of 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol (CID 154498857) is 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol.
What is the SMILES notation for 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol?
The canonical SMILES for 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol is OCC12CCC(CO)(C1)C(O)=C2O.
What is the InChIKey of 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol?
The InChIKey is QNITVHBMMYEDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c10-4-8-1-2-9(3-8,5-11)7(13)6(8)12/h10-13H,1-5H2.
What are the key properties of 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol?
1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol has a molecular weight of 186.21 g/mol, XLogP of 0.47, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(hydroxymethyl)bicyclo[2.2.1]hept-2-ene-2,3-diol is sourced from PubChem (CID 154498857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).