About ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate
ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate (PubChem CID 154499165) has the molecular formula C18H26N2O5
and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate.
Molecular Properties
| Compound Name | ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate |
| PubChem CID | 154499165 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate |
| SMILES | C=C(N(CCO)c1ccc([N+](=O)[O-])cc1C)C(C)(C)CC(=O)OCC |
| InChI | InChI=1S/C18H26N2O5/c1-6-25-17(22)12-18(4,5)14(3)19(9-10-21)16-8-7-15(20(23)24)11-13(16)2/h7-8,11,21H,3,6,9-10,12H2,1-2,4-5H3 |
| InChIKey | SHVPOSSUEUHVLL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate?
The IUPAC name of ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate (CID 154499165) is ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate.
What is the SMILES notation for ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate?
The canonical SMILES for ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate is C=C(N(CCO)c1ccc([N+](=O)[O-])cc1C)C(C)(C)CC(=O)OCC.
What is the InChIKey of ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate?
The InChIKey is SHVPOSSUEUHVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O5/c1-6-25-17(22)12-18(4,5)14(3)19(9-10-21)16-8-7-15(20(23)24)11-13(16)2/h7-8,11,21H,3,6,9-10,12H2,1-2,4-5H3.
What are the key properties of ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate?
ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate has a molecular weight of 350.42 g/mol, XLogP of 3.20, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[N-(2-hydroxyethyl)-2-methyl-4-nitroanilino]-3,3-dimethylpent-4-enoate is sourced from PubChem (CID 154499165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).