C19H33NO2 — CID 154500723
3-(1-cyclohexyl-2,2,6,6-tetramethylpiperidin-4-yl)-2-methylprop-2-enoic acid (PubChem CID 154500723) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 3-(1-cyclohexyl-2,2,6,6-tetramethylpiperidin-4-yl)-2-methylprop-2-enoic acid.
| Compound Name | 3-(1-cyclohexyl-2,2,6,6-tetramethylpiperidin-4-yl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 154500723 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 3-(1-cyclohexyl-2,2,6,6-tetramethylpiperidin-4-yl)-2-methylprop-2-enoic acid |
| SMILES | CC(=CC1CC(C)(C)N(C2CCCCC2)C(C)(C)C1)C(=O)O |
| InChI | InChI=1S/C19H33NO2/c1-14(17(21)22)11-15-12-18(2,3)20(19(4,5)13-15)16-9-7-6-8-10-16/h11,15-16H,6-10,12-13H2,1-5H3,(H,21,22) |
| InChIKey | WAJVYTMQUGWBGJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|