About diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane
diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane (PubChem CID 154500757) has the molecular formula C14H21F3O3Si
and a molecular weight of 322.40 g/mol. Its IUPAC name is diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane.
Molecular Properties
| Compound Name | diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane |
| PubChem CID | 154500757 |
| Molecular Formula | C14H21F3O3Si |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane |
| SMILES | CCOC(OCC)O[SiH2]CCCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H21F3O3Si/c1-3-18-14(19-4-2)20-21-7-5-6-10-8-12(16)13(17)9-11(10)15/h8-9,14H,3-7,21H2,1-2H3 |
| InChIKey | SNMVNHLTLFFWNB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane?
The IUPAC name of diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane (CID 154500757) is diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane.
What is the SMILES notation for diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane?
The canonical SMILES for diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane is CCOC(OCC)O[SiH2]CCCc1cc(F)c(F)cc1F.
What is the InChIKey of diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane?
The InChIKey is SNMVNHLTLFFWNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F3O3Si/c1-3-18-14(19-4-2)20-21-7-5-6-10-8-12(16)13(17)9-11(10)15/h8-9,14H,3-7,21H2,1-2H3.
What are the key properties of diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane?
diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane has a molecular weight of 322.40 g/mol, XLogP of 2.91, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxymethoxy-[3-(2,4,5-trifluorophenyl)propyl]silane is sourced from PubChem (CID 154500757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).