About (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol
(1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol (PubChem CID 154500867) has the molecular formula C5H11N2O+
and a molecular weight of 115.16 g/mol. Its IUPAC name is (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol.
Molecular Properties
| Compound Name | (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol |
| PubChem CID | 154500867 |
| Molecular Formula | C5H11N2O+ |
| Molecular Weight | 115.16 g/mol |
| Exact Mass | 115.09 |
| IUPAC Name | (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol |
| SMILES | C[N+]1(CO)C=NCC1 |
| InChI | InChI=1S/C5H11N2O/c1-7(5-8)3-2-6-4-7/h4,8H,2-3,5H2,1H3/q+1 |
| InChIKey | OKJABISAPPSSBX-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.16 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol?
The IUPAC name of (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol (CID 154500867) is (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol.
What is the SMILES notation for (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol?
The canonical SMILES for (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol is C[N+]1(CO)C=NCC1.
What is the InChIKey of (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol?
The InChIKey is OKJABISAPPSSBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N2O/c1-7(5-8)3-2-6-4-7/h4,8H,2-3,5H2,1H3/q+1.
What are the key properties of (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol?
(1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol has a molecular weight of 115.16 g/mol, XLogP of -0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-4,5-dihydroimidazol-1-ium-1-yl)methanol is sourced from PubChem (CID 154500867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).