C8H16N6 — CID 154502134
4-[(3R)-pyrrolidin-3-yl]-1H-pyrimidine-2,4,6-triamine (PubChem CID 154502134) has the molecular formula C8H16N6 and a molecular weight of 196.26 g/mol. Its IUPAC name is 4-[(3R)-pyrrolidin-3-yl]-1H-pyrimidine-2,4,6-triamine.
| Compound Name | 4-[(3R)-pyrrolidin-3-yl]-1H-pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 154502134 |
| Molecular Formula | C8H16N6 |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 4-[(3R)-pyrrolidin-3-yl]-1H-pyrimidine-2,4,6-triamine |
| SMILES | NC1=CC(N)([C@@H]2CCNC2)N=C(N)N1 |
| InChI | InChI=1S/C8H16N6/c9-6-3-8(11,14-7(10)13-6)5-1-2-12-4-5/h3,5,12H,1-2,4,9,11H2,(H3,10,13,14)/t5-,8?/m1/s1 |
| InChIKey | MKYFDDBYQKVXSQ-RUQIKYNFSA-N |
| XLogP | -2.03 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |