C10H17N3 — CID 154502297
2-N,5-N-di(propan-2-yl)pyrrole-2,5-diimine (PubChem CID 154502297) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-N,5-N-di(propan-2-yl)pyrrole-2,5-diimine.
| Compound Name | 2-N,5-N-di(propan-2-yl)pyrrole-2,5-diimine |
|---|---|
| PubChem CID | 154502297 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-N,5-N-di(propan-2-yl)pyrrole-2,5-diimine |
| SMILES | CC(C)/N=C1\C=C/C(=N\C(C)C)N1 |
| InChI | InChI=1S/C10H17N3/c1-7(2)11-9-5-6-10(13-9)12-8(3)4/h5-8H,1-4H3,(H,11,12,13) |
| InChIKey | MRAZZXWFUKOPHH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|