About 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene
1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene (PubChem CID 154502465) has the molecular formula C13H19ClO
and a molecular weight of 226.75 g/mol. Its IUPAC name is 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene.
Molecular Properties
| Compound Name | 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene |
| PubChem CID | 154502465 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene |
| SMILES | CCOc1c(C)c(C)c(Cl)c(C)c1CC |
| InChI | InChI=1S/C13H19ClO/c1-6-11-10(5)12(14)8(3)9(4)13(11)15-7-2/h6-7H2,1-5H3 |
| InChIKey | WQNOZYPNTMCBTG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene?
The IUPAC name of 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene (CID 154502465) is 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene.
What is the SMILES notation for 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene?
The canonical SMILES for 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene is CCOc1c(C)c(C)c(Cl)c(C)c1CC.
What is the InChIKey of 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene?
The InChIKey is WQNOZYPNTMCBTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClO/c1-6-11-10(5)12(14)8(3)9(4)13(11)15-7-2/h6-7H2,1-5H3.
What are the key properties of 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene?
1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene has a molecular weight of 226.75 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-ethoxy-3-ethyl-2,5,6-trimethylbenzene is sourced from PubChem (CID 154502465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).