C10H11BrN2O4S — CID 154503190
(6R)-7-acetamido-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid (PubChem CID 154503190) has the molecular formula C10H11BrN2O4S and a molecular weight of 335.18 g/mol. Its IUPAC name is (6R)-7-acetamido-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid.
| Compound Name | (6R)-7-acetamido-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154503190 |
| Molecular Formula | C10H11BrN2O4S |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | (6R)-7-acetamido-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylic acid |
| SMILES | CC(=O)NC1C(=O)N2C(C(=O)O)C(CBr)=CS[C@H]12 |
| InChI | InChI=1S/C10H11BrN2O4S/c1-4(14)12-6-8(15)13-7(10(16)17)5(2-11)3-18-9(6)13/h3,6-7,9H,2H2,1H3,(H,12,14)(H,16,17)/t6?,7?,9-/m1/s1 |
| InChIKey | UEEBSUZUFHUBFQ-QXUHLLMWSA-N |
| XLogP | 0.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|