C21H28O5 — CID 15450374
methyl (1R,5E,9Z,11S,12S)-2-methylidene-14-oxo-9-propan-2-yl-13,15-dioxatricyclo[10.3.2.01,11]heptadeca-5,9-diene-6-carboxylate (PubChem CID 15450374) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is methyl (1R,5E,9Z,11S,12S)-2-methylidene-14-oxo-9-propan-2-yl-13,15-dioxatricyclo[10.3.2.01,11]heptadeca-5,9-diene-6-carboxylate.
| Compound Name | methyl (1R,5E,9Z,11S,12S)-2-methylidene-14-oxo-9-propan-2-yl-13,15-dioxatricyclo[10.3.2.01,11]heptadeca-5,9-diene-6-carboxylate |
|---|---|
| PubChem CID | 15450374 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | methyl (1R,5E,9Z,11S,12S)-2-methylidene-14-oxo-9-propan-2-yl-13,15-dioxatricyclo[10.3.2.01,11]heptadeca-5,9-diene-6-carboxylate |
| SMILES | C=C1CC/C=C(/C(=O)OC)CC/C(C(C)C)=C/[C@H]2[C@@H]3CC[C@]12OC(=O)O3 |
| InChI | InChI=1S/C21H28O5/c1-13(2)16-9-8-15(19(22)24-4)7-5-6-14(3)21-11-10-18(17(21)12-16)25-20(23)26-21/h7,12-13,17-18H,3,5-6,8-11H2,1-2,4H3/b15-7+,16-12-/t17-,18-,21-/m0/s1 |
| InChIKey | ZEJNJZGURPPEGP-WTMORYAPSA-N |
| XLogP | 4.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|