C12H20N2O7 — CID 15450383
(2R,3aR,6S,7R,7aR)-2-[(2S)-2-azaniumyl-2-carboxylatoethyl]-6-hydroxy-7-(methylazaniumyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 15450383) has the molecular formula C12H20N2O7 and a molecular weight of 304.30 g/mol. Its IUPAC name is (2R,3aR,6S,7R,7aR)-2-[(2S)-2-azaniumyl-2-carboxylatoethyl]-6-hydroxy-7-(methylazaniumyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | (2R,3aR,6S,7R,7aR)-2-[(2S)-2-azaniumyl-2-carboxylatoethyl]-6-hydroxy-7-(methylazaniumyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 15450383 |
| Molecular Formula | C12H20N2O7 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (2R,3aR,6S,7R,7aR)-2-[(2S)-2-azaniumyl-2-carboxylatoethyl]-6-hydroxy-7-(methylazaniumyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | C[NH2+][C@H]1[C@H]2O[C@@](C[C@H]([NH3+])C(=O)[O-])(C(=O)[O-])C[C@H]2OC[C@H]1O |
| InChI | InChI=1S/C12H20N2O7/c1-14-8-6(15)4-20-7-3-12(11(18)19,21-9(7)8)2-5(13)10(16)17/h5-9,14-15H,2-4,13H2,1H3,(H,16,17)(H,18,19)/t5-,6+,7+,8+,9-,12+/m0/s1 |
| InChIKey | YUSZFKPLFIQTGF-FDNSHYBFSA-N |
| XLogP | -6.66 |
| TPSA | 163.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |