C20H28O2 — CID 15450497
(4S,5S,8R,10E,13R)-8,11-dimethyl-5-prop-1-en-2-yl-14-oxatricyclo[11.2.1.04,8]hexadeca-1(16),10-dien-15-one (PubChem CID 15450497) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (4S,5S,8R,10E,13R)-8,11-dimethyl-5-prop-1-en-2-yl-14-oxatricyclo[11.2.1.04,8]hexadeca-1(16),10-dien-15-one.
| Compound Name | (4S,5S,8R,10E,13R)-8,11-dimethyl-5-prop-1-en-2-yl-14-oxatricyclo[11.2.1.04,8]hexadeca-1(16),10-dien-15-one |
|---|---|
| PubChem CID | 15450497 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (4S,5S,8R,10E,13R)-8,11-dimethyl-5-prop-1-en-2-yl-14-oxatricyclo[11.2.1.04,8]hexadeca-1(16),10-dien-15-one |
| SMILES | C=C(C)[C@H]1CC[C@]2(C)C/C=C(/C)C[C@@H]3C=C(CC[C@@H]12)C(=O)O3 |
| InChI | InChI=1S/C20H28O2/c1-13(2)17-8-10-20(4)9-7-14(3)11-16-12-15(19(21)22-16)5-6-18(17)20/h7,12,16-18H,1,5-6,8-11H2,2-4H3/b14-7-/t16-,17-,18+,20+/m1/s1 |
| InChIKey | GZHVHSGVLXHODS-GMQINBAYSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|