About 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one
7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one (PubChem CID 154505014) has the molecular formula C14H14BrF3N2O
and a molecular weight of 363.18 g/mol. Its IUPAC name is 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one.
Molecular Properties
| Compound Name | 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one |
| PubChem CID | 154505014 |
| Molecular Formula | C14H14BrF3N2O |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one |
| SMILES | CN1C(=O)N(c2ccc(C(F)(F)F)cc2)CCC=C1CBr |
| InChI | InChI=1S/C14H14BrF3N2O/c1-19-12(9-15)3-2-8-20(13(19)21)11-6-4-10(5-7-11)14(16,17)18/h3-7H,2,8-9H2,1H3 |
| InChIKey | PFDPYCDSXDWSBS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one?
The IUPAC name of 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one (CID 154505014) is 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one.
What is the SMILES notation for 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one?
The canonical SMILES for 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one is CN1C(=O)N(c2ccc(C(F)(F)F)cc2)CCC=C1CBr.
What is the InChIKey of 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one?
The InChIKey is PFDPYCDSXDWSBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrF3N2O/c1-19-12(9-15)3-2-8-20(13(19)21)11-6-4-10(5-7-11)14(16,17)18/h3-7H,2,8-9H2,1H3.
What are the key properties of 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one?
7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one has a molecular weight of 363.18 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(bromomethyl)-1-methyl-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-diazepin-2-one is sourced from PubChem (CID 154505014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).