C26H26N3O4S+ — CID 154505042
3-[2-[[3-(2-carboxyethyl)-5-methyl-1,3-benzothiazol-3-ium-2-yl]-cyanomethylidene]-3,3-dimethylindol-1-yl]propanoic acid (PubChem CID 154505042) has the molecular formula C26H26N3O4S+ and a molecular weight of 476.58 g/mol. Its IUPAC name is 3-[2-[[3-(2-carboxyethyl)-5-methyl-1,3-benzothiazol-3-ium-2-yl]-cyanomethylidene]-3,3-dimethylindol-1-yl]propanoic acid.
| Compound Name | 3-[2-[[3-(2-carboxyethyl)-5-methyl-1,3-benzothiazol-3-ium-2-yl]-cyanomethylidene]-3,3-dimethylindol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 154505042 |
| Molecular Formula | C26H26N3O4S+ |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 3-[2-[[3-(2-carboxyethyl)-5-methyl-1,3-benzothiazol-3-ium-2-yl]-cyanomethylidene]-3,3-dimethylindol-1-yl]propanoic acid |
| SMILES | Cc1ccc2sc(C(C#N)=C3N(CCC(=O)O)c4ccccc4C3(C)C)[n+](CCC(=O)O)c2c1 |
| InChI | InChI=1S/C26H25N3O4S/c1-16-8-9-21-20(14-16)29(13-11-23(32)33)25(34-21)17(15-27)24-26(2,3)18-6-4-5-7-19(18)28(24)12-10-22(30)31/h4-9,14H,10-13H2,1-3H3,(H-,30,31,32,33)/p+1 |
| InChIKey | WUNMNKFZFZJQMV-UHFFFAOYSA-O |
| XLogP | 4.48 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|