About 3-ethyl-1,2-dimethyl-2H-pyrazine
3-ethyl-1,2-dimethyl-2H-pyrazine (PubChem CID 154505281) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 3-ethyl-1,2-dimethyl-2H-pyrazine.
Molecular Properties
| Compound Name | 3-ethyl-1,2-dimethyl-2H-pyrazine |
| PubChem CID | 154505281 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 3-ethyl-1,2-dimethyl-2H-pyrazine |
| SMILES | CCC1=NC=CN(C)C1C |
| InChI | InChI=1S/C8H14N2/c1-4-8-7(2)10(3)6-5-9-8/h5-7H,4H2,1-3H3 |
| InChIKey | LFBDWCHEEXSKOR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1,2-dimethyl-2H-pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,2-dimethyl-2H-pyrazine?
The IUPAC name of 3-ethyl-1,2-dimethyl-2H-pyrazine (CID 154505281) is 3-ethyl-1,2-dimethyl-2H-pyrazine.
What is the SMILES notation for 3-ethyl-1,2-dimethyl-2H-pyrazine?
The canonical SMILES for 3-ethyl-1,2-dimethyl-2H-pyrazine is CCC1=NC=CN(C)C1C.
What is the InChIKey of 3-ethyl-1,2-dimethyl-2H-pyrazine?
The InChIKey is LFBDWCHEEXSKOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-8-7(2)10(3)6-5-9-8/h5-7H,4H2,1-3H3.
What are the key properties of 3-ethyl-1,2-dimethyl-2H-pyrazine?
3-ethyl-1,2-dimethyl-2H-pyrazine has a molecular weight of 138.21 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,2-dimethyl-2H-pyrazine is sourced from PubChem (CID 154505281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).