C23H15F4N2O3- — CID 154505753
2-fluoro-4-[N-[3-methyl-4-[2-(trifluoromethyl)phenyl]benzoyl]carbamimidoyl]benzoate (PubChem CID 154505753) has the molecular formula C23H15F4N2O3- and a molecular weight of 443.38 g/mol. Its IUPAC name is 2-fluoro-4-[N-[3-methyl-4-[2-(trifluoromethyl)phenyl]benzoyl]carbamimidoyl]benzoate.
| Compound Name | 2-fluoro-4-[N-[3-methyl-4-[2-(trifluoromethyl)phenyl]benzoyl]carbamimidoyl]benzoate |
|---|---|
| PubChem CID | 154505753 |
| Molecular Formula | C23H15F4N2O3- |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-fluoro-4-[N-[3-methyl-4-[2-(trifluoromethyl)phenyl]benzoyl]carbamimidoyl]benzoate |
| SMILES | [H]/N=C(/NC(=O)c1ccc(-c2ccccc2C(F)(F)F)c(C)c1)c1ccc(C(=O)[O-])c(F)c1 |
| InChI | InChI=1S/C23H16F4N2O3/c1-12-10-14(7-8-15(12)16-4-2-3-5-18(16)23(25,26)27)21(30)29-20(28)13-6-9-17(22(31)32)19(24)11-13/h2-11H,1H3,(H,31,32)(H2,28,29,30)/p-1 |
| InChIKey | WSYFEXHVEBYYAA-UHFFFAOYSA-M |
| XLogP | 3.94 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|