C23H31N3O3S — CID 154505841
2-[(1R)-3-[(1S,2S,3R)-2-[(2,3-dihydro-1H-inden-5-ylamino)methyl]-3-hydroxy-5-methylcyclopentyl]-1-hydroxypropyl]-1,3-thiazole-4-carboxamide (PubChem CID 154505841) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 2-[(1R)-3-[(1S,2S,3R)-2-[(2,3-dihydro-1H-inden-5-ylamino)methyl]-3-hydroxy-5-methylcyclopentyl]-1-hydroxypropyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(1R)-3-[(1S,2S,3R)-2-[(2,3-dihydro-1H-inden-5-ylamino)methyl]-3-hydroxy-5-methylcyclopentyl]-1-hydroxypropyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 154505841 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-[(1R)-3-[(1S,2S,3R)-2-[(2,3-dihydro-1H-inden-5-ylamino)methyl]-3-hydroxy-5-methylcyclopentyl]-1-hydroxypropyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC1C[C@@H](O)[C@H](CNc2ccc3c(c2)CCC3)[C@H]1CC[C@@H](O)c1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C23H31N3O3S/c1-13-9-21(28)18(11-25-16-6-5-14-3-2-4-15(14)10-16)17(13)7-8-20(27)23-26-19(12-30-23)22(24)29/h5-6,10,12-13,17-18,20-21,25,27-28H,2-4,7-9,11H2,1H3,(H2,24,29)/t13?,17-,18+,20+,21+/m0/s1 |
| InChIKey | PLECFEBRERLWIC-KVUHTTHBSA-N |
| XLogP | 3.29 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |