C20H19FO5S — CID 15450637
[(2R,3S,4S,5S)-3-benzoyloxy-4-fluoro-5-methoxythiolan-2-yl]methyl benzoate (PubChem CID 15450637) has the molecular formula C20H19FO5S and a molecular weight of 390.43 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-3-benzoyloxy-4-fluoro-5-methoxythiolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5S)-3-benzoyloxy-4-fluoro-5-methoxythiolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 15450637 |
| Molecular Formula | C20H19FO5S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [(2R,3S,4S,5S)-3-benzoyloxy-4-fluoro-5-methoxythiolan-2-yl]methyl benzoate |
| SMILES | CO[C@H]1S[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C20H19FO5S/c1-24-20-16(21)17(26-19(23)14-10-6-3-7-11-14)15(27-20)12-25-18(22)13-8-4-2-5-9-13/h2-11,15-17,20H,12H2,1H3/t15-,16+,17-,20+/m1/s1 |
| InChIKey | WUBPGNSEZZQBOT-YZLZLFLDSA-N |
| XLogP | 3.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |