About 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one
1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one (PubChem CID 154506718) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one |
| PubChem CID | 154506718 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one |
| SMILES | CCN1C(=O)OCc2cncnc21 |
| InChI | InChI=1S/C8H9N3O2/c1-2-11-7-6(3-9-5-10-7)4-13-8(11)12/h3,5H,2,4H2,1H3 |
| InChIKey | CQJNLSGCAFSGOF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one?
The IUPAC name of 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one (CID 154506718) is 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one.
What is the SMILES notation for 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one?
The canonical SMILES for 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one is CCN1C(=O)OCc2cncnc21.
What is the InChIKey of 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one?
The InChIKey is CQJNLSGCAFSGOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-2-11-7-6(3-9-5-10-7)4-13-8(11)12/h3,5H,2,4H2,1H3.
What are the key properties of 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one?
1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one has a molecular weight of 179.18 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4H-pyrimido[4,5-d][1,3]oxazin-2-one is sourced from PubChem (CID 154506718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).