About 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene
1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene (PubChem CID 154506990) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene.
Molecular Properties
| Compound Name | 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene |
| PubChem CID | 154506990 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene |
| SMILES | CC1(C)C=C(N=C=O)CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C12H16N2O2/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15/h4H,5-7H2,1-3H3 |
| InChIKey | NAMSWTSYRNWRMP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene?
The IUPAC name of 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene (CID 154506990) is 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene.
What is the SMILES notation for 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene?
The canonical SMILES for 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene is CC1(C)C=C(N=C=O)CC(C)(CN=C=O)C1.
What is the InChIKey of 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene?
The InChIKey is NAMSWTSYRNWRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15/h4H,5-7H2,1-3H3.
What are the key properties of 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene?
1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene has a molecular weight of 220.27 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanato-5-(isocyanatomethyl)-3,3,5-trimethylcyclohexene is sourced from PubChem (CID 154506990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).