C13H13BrF2N2OS — CID 154508638
8a-(5-bromo-2,4-difluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine (PubChem CID 154508638) has the molecular formula C13H13BrF2N2OS and a molecular weight of 363.23 g/mol. Its IUPAC name is 8a-(5-bromo-2,4-difluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine.
| Compound Name | 8a-(5-bromo-2,4-difluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 154508638 |
| Molecular Formula | C13H13BrF2N2OS |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 8a-(5-bromo-2,4-difluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine |
| SMILES | NC1=NC2(c3cc(Br)c(F)cc3F)CCOCC2CS1 |
| InChI | InChI=1S/C13H13BrF2N2OS/c14-9-3-8(10(15)4-11(9)16)13-1-2-19-5-7(13)6-20-12(17)18-13/h3-4,7H,1-2,5-6H2,(H2,17,18) |
| InChIKey | ZOVFXDLTXVKFFT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|