About hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium
hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium (PubChem CID 154510730) has the molecular formula C8H13F3O2P+
and a molecular weight of 229.16 g/mol. Its IUPAC name is hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium.
Molecular Properties
| Compound Name | hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium |
| PubChem CID | 154510730 |
| Molecular Formula | C8H13F3O2P+ |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium |
| SMILES | CCCCC=C[P+](=O)OCC(F)(F)F |
| InChI | InChI=1S/C8H13F3O2P/c1-2-3-4-5-6-14(12)13-7-8(9,10)11/h5-6H,2-4,7H2,1H3/q+1 |
| InChIKey | NZQOSFSBUXBTPL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium?
The IUPAC name of hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium (CID 154510730) is hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium.
What is the SMILES notation for hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium?
The canonical SMILES for hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium is CCCCC=C[P+](=O)OCC(F)(F)F.
What is the InChIKey of hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium?
The InChIKey is NZQOSFSBUXBTPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3O2P/c1-2-3-4-5-6-14(12)13-7-8(9,10)11/h5-6H,2-4,7H2,1H3/q+1.
What are the key properties of hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium?
hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium has a molecular weight of 229.16 g/mol, XLogP of 4.01, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-1-enyl-oxo-(2,2,2-trifluoroethoxy)phosphanium is sourced from PubChem (CID 154510730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).