C17H6F12O6S2-2 — CID 154510843
3-[[3-sulfonato-2,6-bis(trifluoromethyl)phenyl]methyl]-2,4-bis(trifluoromethyl)benzenesulfonate (PubChem CID 154510843) has the molecular formula C17H6F12O6S2-2 and a molecular weight of 598.34 g/mol. Its IUPAC name is 3-[[3-sulfonato-2,6-bis(trifluoromethyl)phenyl]methyl]-2,4-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | 3-[[3-sulfonato-2,6-bis(trifluoromethyl)phenyl]methyl]-2,4-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 154510843 |
| Molecular Formula | C17H6F12O6S2-2 |
| Molecular Weight | 598.34 g/mol |
| Exact Mass | 597.94 |
| IUPAC Name | 3-[[3-sulfonato-2,6-bis(trifluoromethyl)phenyl]methyl]-2,4-bis(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(C(F)(F)F)c(Cc2c(C(F)(F)F)ccc(S(=O)(=O)[O-])c2C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C17H8F12O6S2/c18-14(19,20)8-1-3-10(36(30,31)32)12(16(24,25)26)6(8)5-7-9(15(21,22)23)2-4-11(37(33,34)35)13(7)17(27,28)29/h1-4H,5H2,(H,30,31,32)(H,33,34,35)/p-2 |
| InChIKey | WWNKCTFRHIXYPP-UHFFFAOYSA-L |
| XLogP | 5.16 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.34 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|