About magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide
magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide (PubChem CID 154510881) has the molecular formula C9H10BrMgN
and a molecular weight of 236.39 g/mol. Its IUPAC name is magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide.
Molecular Properties
| Compound Name | magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide |
| PubChem CID | 154510881 |
| Molecular Formula | C9H10BrMgN |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide |
| SMILES | [Br-].[Mg+2].c1ccc2c(c1)CCC[N-]2 |
| InChI | InChI=1S/C9H10N.BrH.Mg/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-2,4,6H,3,5,7H2;1H;/q-1;;+2/p-1 |
| InChIKey | TZDQRFJOIVCCII-UHFFFAOYSA-M |
| XLogP | -0.74 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide?
The IUPAC name of magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide (CID 154510881) is magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide.
What is the SMILES notation for magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide?
The canonical SMILES for magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide is [Br-].[Mg+2].c1ccc2c(c1)CCC[N-]2.
What is the InChIKey of magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide?
The InChIKey is TZDQRFJOIVCCII-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10N.BrH.Mg/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-2,4,6H,3,5,7H2;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide?
magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide has a molecular weight of 236.39 g/mol, XLogP of -0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;3,4-dihydro-2H-quinolin-1-ide;bromide is sourced from PubChem (CID 154510881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).