C21H27N — CID 154511159
[4-(2,2-diphenylethyl)cyclohexyl]methanamine (PubChem CID 154511159) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is [4-(2,2-diphenylethyl)cyclohexyl]methanamine.
| Compound Name | [4-(2,2-diphenylethyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 154511159 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | [4-(2,2-diphenylethyl)cyclohexyl]methanamine |
| SMILES | NCC1CCC(CC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H27N/c22-16-18-13-11-17(12-14-18)15-21(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-10,17-18,21H,11-16,22H2 |
| InChIKey | DHYGDZKESAXGLE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |