C39H35NO4 — CID 15451140
4-[4-[5-(4-methoxyphenyl)-21,21-dimethyl-6,22-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-5-yl]phenyl]morpholine (PubChem CID 15451140) has the molecular formula C39H35NO4 and a molecular weight of 581.71 g/mol. Its IUPAC name is 4-[4-[5-(4-methoxyphenyl)-21,21-dimethyl-6,22-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-5-yl]phenyl]morpholine.
| Compound Name | 4-[4-[5-(4-methoxyphenyl)-21,21-dimethyl-6,22-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 15451140 |
| Molecular Formula | C39H35NO4 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | 4-[4-[5-(4-methoxyphenyl)-21,21-dimethyl-6,22-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-5-yl]phenyl]morpholine |
| SMILES | COc1ccc(C2(c3ccc(N4CCOCC4)cc3)C=Cc3c4c(c5ccccc5c3O2)-c2ccccc2C(C)(C)O4)cc1 |
| InChI | InChI=1S/C39H35NO4/c1-38(2)34-11-7-6-10-32(34)35-30-8-4-5-9-31(30)36-33(37(35)43-38)20-21-39(44-36,27-14-18-29(41-3)19-15-27)26-12-16-28(17-13-26)40-22-24-42-25-23-40/h4-21H,22-25H2,1-3H3 |
| InChIKey | CKRILCYBLQGZPO-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|