About (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate
(3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate (PubChem CID 154511479) has the molecular formula C26H21NO2S
and a molecular weight of 411.53 g/mol. Its IUPAC name is (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate.
Molecular Properties
| Compound Name | (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate |
| PubChem CID | 154511479 |
| Molecular Formula | C26H21NO2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate |
| SMILES | Cc1csc(OC(=O)C2c3ccccc3N(c3ccccc3)c3ccccc32)c1C |
| InChI | InChI=1S/C26H21NO2S/c1-17-16-30-26(18(17)2)29-25(28)24-20-12-6-8-14-22(20)27(19-10-4-3-5-11-19)23-15-9-7-13-21(23)24/h3-16,24H,1-2H3 |
| InChIKey | KQIVTVZYWPCAMK-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate?
The IUPAC name of (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate (CID 154511479) is (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate.
What is the SMILES notation for (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate?
The canonical SMILES for (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate is Cc1csc(OC(=O)C2c3ccccc3N(c3ccccc3)c3ccccc32)c1C.
What is the InChIKey of (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate?
The InChIKey is KQIVTVZYWPCAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21NO2S/c1-17-16-30-26(18(17)2)29-25(28)24-20-12-6-8-14-22(20)27(19-10-4-3-5-11-19)23-15-9-7-13-21(23)24/h3-16,24H,1-2H3.
What are the key properties of (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate?
(3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate has a molecular weight of 411.53 g/mol, XLogP of 6.89, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylthiophen-2-yl) 10-phenyl-9H-acridine-9-carboxylate is sourced from PubChem (CID 154511479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).