C18H22FNO — CID 154512400
N-[2-[3-[(2-fluorophenyl)methoxy]phenyl]ethyl]propan-2-amine (PubChem CID 154512400) has the molecular formula C18H22FNO and a molecular weight of 287.38 g/mol. Its IUPAC name is N-[2-[3-[(2-fluorophenyl)methoxy]phenyl]ethyl]propan-2-amine.
| Compound Name | N-[2-[3-[(2-fluorophenyl)methoxy]phenyl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 154512400 |
| Molecular Formula | C18H22FNO |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[2-[3-[(2-fluorophenyl)methoxy]phenyl]ethyl]propan-2-amine |
| SMILES | CC(C)NCCc1cccc(OCc2ccccc2F)c1 |
| InChI | InChI=1S/C18H22FNO/c1-14(2)20-11-10-15-6-5-8-17(12-15)21-13-16-7-3-4-9-18(16)19/h3-9,12,14,20H,10-11,13H2,1-2H3 |
| InChIKey | CRLXZTVNHXPUJU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |