C18H24N4O7S — CID 15451271
methyl (2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-phenylsulfanyloxane-2-carboxylate (PubChem CID 15451271) has the molecular formula C18H24N4O7S and a molecular weight of 440.48 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 15451271 |
| Molecular Formula | C18H24N4O7S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | methyl (2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@H](O)[C@@H](NC(C)=O)[C@H]([C@H](O)[C@H](O)CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C18H24N4O7S/c1-10(23)21-14-12(24)8-18(17(27)28-2,30-11-6-4-3-5-7-11)29-16(14)15(26)13(25)9-20-22-19/h3-7,12-16,24-26H,8-9H2,1-2H3,(H,21,23)/t12-,13+,14+,15+,16+,18+/m0/s1 |
| InChIKey | DLYHHZCDRLMSQF-DGYIVEFISA-N |
| XLogP | 0.33 |
| TPSA | 174.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|