C15H24N6 — CID 154514770
3-[(7S)-7-(dimethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,2-dihydro-1,2,4-triazole-3,5-diamine (PubChem CID 154514770) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is 3-[(7S)-7-(dimethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,2-dihydro-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-[(7S)-7-(dimethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,2-dihydro-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 154514770 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 3-[(7S)-7-(dimethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-1,2-dihydro-1,2,4-triazole-3,5-diamine |
| SMILES | CN(C)[C@H]1CCc2ccc(C3(N)N=C(N)NN3)cc2CC1 |
| InChI | InChI=1S/C15H24N6/c1-21(2)13-7-4-10-3-6-12(9-11(10)5-8-13)15(17)18-14(16)19-20-15/h3,6,9,13,20H,4-5,7-8,17H2,1-2H3,(H3,16,18,19)/t13-,15?/m0/s1 |
| InChIKey | FGGLRQCKYILASQ-CFMCSPIPSA-N |
| XLogP | -0.01 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |