About N'-methanimidoyl-N,N-dimethylmethanimidamide
N'-methanimidoyl-N,N-dimethylmethanimidamide (PubChem CID 154515557) has the molecular formula C4H9N3
and a molecular weight of 99.14 g/mol. Its IUPAC name is N'-methanimidoyl-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-methanimidoyl-N,N-dimethylmethanimidamide |
| PubChem CID | 154515557 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | N'-methanimidoyl-N,N-dimethylmethanimidamide |
| SMILES | [H]/N=C/N=C/N(C)C |
| InChI | InChI=1S/C4H9N3/c1-7(2)4-6-3-5/h3-5H,1-2H3/b5-3+,6-4+ |
| InChIKey | DGRWWXPXCMKVIN-GGWOSOGESA-N |
| XLogP | 0.18 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-methanimidoyl-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methanimidoyl-N,N-dimethylmethanimidamide?
The IUPAC name of N'-methanimidoyl-N,N-dimethylmethanimidamide (CID 154515557) is N'-methanimidoyl-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-methanimidoyl-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-methanimidoyl-N,N-dimethylmethanimidamide is [H]/N=C/N=C/N(C)C.
What is the InChIKey of N'-methanimidoyl-N,N-dimethylmethanimidamide?
The InChIKey is DGRWWXPXCMKVIN-GGWOSOGESA-N. The full InChI is InChI=1S/C4H9N3/c1-7(2)4-6-3-5/h3-5H,1-2H3/b5-3+,6-4+.
What are the key properties of N'-methanimidoyl-N,N-dimethylmethanimidamide?
N'-methanimidoyl-N,N-dimethylmethanimidamide has a molecular weight of 99.14 g/mol, XLogP of 0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methanimidoyl-N,N-dimethylmethanimidamide is sourced from PubChem (CID 154515557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).