About 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol
1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol (PubChem CID 154515690) has the molecular formula C9H11F3O
and a molecular weight of 192.18 g/mol. Its IUPAC name is 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol.
Molecular Properties
| Compound Name | 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol |
| PubChem CID | 154515690 |
| Molecular Formula | C9H11F3O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol |
| SMILES | CC(O)C1C=CC=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H11F3O/c1-6(13)7-3-2-4-8(5-7)9(10,11)12/h2-4,6-7,13H,5H2,1H3 |
| InChIKey | RREROJRFNKWKBK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol?
The IUPAC name of 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol (CID 154515690) is 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol.
What is the SMILES notation for 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol?
The canonical SMILES for 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol is CC(O)C1C=CC=C(C(F)(F)F)C1.
What is the InChIKey of 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol?
The InChIKey is RREROJRFNKWKBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3O/c1-6(13)7-3-2-4-8(5-7)9(10,11)12/h2-4,6-7,13H,5H2,1H3.
What are the key properties of 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol?
1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol has a molecular weight of 192.18 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanol is sourced from PubChem (CID 154515690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).