C5H11NS — CID 154515797
2,3-dimethyl-1,2-thiazolidine (PubChem CID 154515797) has the molecular formula C5H11NS and a molecular weight of 117.22 g/mol. Its IUPAC name is 2,3-dimethyl-1,2-thiazolidine.
| Compound Name | 2,3-dimethyl-1,2-thiazolidine |
|---|---|
| PubChem CID | 154515797 |
| Molecular Formula | C5H11NS |
| Molecular Weight | 117.22 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | 2,3-dimethyl-1,2-thiazolidine |
| SMILES | CC1CCSN1C |
| InChI | InChI=1S/C5H11NS/c1-5-3-4-7-6(5)2/h5H,3-4H2,1-2H3 |
| InChIKey | JBFDVLLQTPBMFG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|