C18H28O2 — CID 154516028
3-ethyl-1-methoxy-5,5,8,8-tetramethyl-1,2,6,7-tetrahydronaphthalene-2-carbaldehyde (PubChem CID 154516028) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 3-ethyl-1-methoxy-5,5,8,8-tetramethyl-1,2,6,7-tetrahydronaphthalene-2-carbaldehyde.
| Compound Name | 3-ethyl-1-methoxy-5,5,8,8-tetramethyl-1,2,6,7-tetrahydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 154516028 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 3-ethyl-1-methoxy-5,5,8,8-tetramethyl-1,2,6,7-tetrahydronaphthalene-2-carbaldehyde |
| SMILES | CCC1=CC2=C(C(OC)C1C=O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C18H28O2/c1-7-12-10-14-15(16(20-6)13(12)11-19)18(4,5)9-8-17(14,2)3/h10-11,13,16H,7-9H2,1-6H3 |
| InChIKey | VJDTZDSTHSDRDJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|