C8H12N4O — CID 15451604
N,N-dimethyl-N'-(5-methyl-6-oxo-1H-pyrimidin-2-yl)methanimidamide (PubChem CID 15451604) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is N,N-dimethyl-N'-(5-methyl-6-oxo-1H-pyrimidin-2-yl)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(5-methyl-6-oxo-1H-pyrimidin-2-yl)methanimidamide |
|---|---|
| PubChem CID | 15451604 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | N,N-dimethyl-N'-(5-methyl-6-oxo-1H-pyrimidin-2-yl)methanimidamide |
| SMILES | Cc1cnc(/N=C/N(C)C)[nH]c1=O |
| InChI | InChI=1S/C8H12N4O/c1-6-4-9-8(11-7(6)13)10-5-12(2)3/h4-5H,1-3H3,(H,9,11,13)/b10-5+ |
| InChIKey | VQFPWFLMEYFBIK-BJMVGYQFSA-N |
| XLogP | 0.30 |
| TPSA | 61.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|