C27H30ClN9O — CID 15451635
N-[3-(4-amino-7,8-dihydropurino[9,8-a]imidazol-6-yl)propyl]-N'-(6-chloro-2-methoxyacridin-9-yl)propane-1,3-diamine (PubChem CID 15451635) has the molecular formula C27H30ClN9O and a molecular weight of 532.05 g/mol. Its IUPAC name is N-[3-(4-amino-7,8-dihydropurino[9,8-a]imidazol-6-yl)propyl]-N'-(6-chloro-2-methoxyacridin-9-yl)propane-1,3-diamine.
| Compound Name | N-[3-(4-amino-7,8-dihydropurino[9,8-a]imidazol-6-yl)propyl]-N'-(6-chloro-2-methoxyacridin-9-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 15451635 |
| Molecular Formula | C27H30ClN9O |
| Molecular Weight | 532.05 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | N-[3-(4-amino-7,8-dihydropurino[9,8-a]imidazol-6-yl)propyl]-N'-(6-chloro-2-methoxyacridin-9-yl)propane-1,3-diamine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCCNCCCN3CCn4c3nc3c(N)ncnc34)c2c1 |
| InChI | InChI=1S/C27H30ClN9O/c1-38-18-5-7-21-20(15-18)23(19-6-4-17(28)14-22(19)34-21)31-10-2-8-30-9-3-11-36-12-13-37-26-24(35-27(36)37)25(29)32-16-33-26/h4-7,14-16,30H,2-3,8-13H2,1H3,(H,31,34)(H2,29,32,33) |
| InChIKey | GNIYUIJKKXAPRF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.05 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|